ChemNet > CAS > 459-59-6 4-Fluoro-N-methylaniline
459-59-6 4-Fluoro-N-methylaniline
| product Name |
4-Fluoro-N-methylaniline |
| CAS No |
459-59-6 |
| Synonyms |
4-Fluoro-N-toluidine |
| Molecular Formula |
C7H8FN |
| Molecular Weight |
125.1435 |
| InChI |
InChI=1/C7H8FN/c1-9-7-4-2-6(8)3-5-7/h2-5,9H,1H3 |
| EINECS |
207-294-1 |
| Molecular Structure |
|
| Density |
1.106g/cm3 |
| Boiling point |
181.4°C at 760 mmHg |
| Refractive index |
1.546 |
| Flash point |
63.5°C |
| Vapour Pressur |
0.853mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
