ChemNet > CAS > 4593-90-2 (+/-)-3-phenylbutyric acid
4593-90-2 (+/-)-3-phenylbutyric acid
| product Name |
(+/-)-3-phenylbutyric acid |
| CAS No |
4593-90-2 |
| Synonyms |
3-Phenylbutyric acid; 3-phenylbutanoic acid |
| Molecular Formula |
C10H12O2 |
| Molecular Weight |
164.2011 |
| InChI |
InChI=1/C10H12O2/c1-8(7-10(11)12)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,11,12) |
| EINECS |
224-987-4 |
| Molecular Structure |
|
| Density |
1.09g/cm3 |
| Melting point |
35-38℃ |
| Boiling point |
288°C at 760 mmHg |
| Refractive index |
1.531 |
| Flash point |
170.2°C |
| Vapour Pressur |
0.00112mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
