ChemNet > CAS > 4617-33-8 15-Hydroxypentadecanoic acid
4617-33-8 15-Hydroxypentadecanoic acid
| product Name |
15-Hydroxypentadecanoic acid |
| CAS No |
4617-33-8 |
| Synonyms |
15-hydroxypentadecanoate; Pentadecanoic acid, 15-hydroxy- |
| Molecular Formula |
C15H29O3 |
| Molecular Weight |
257.3895 |
| InChI |
InChI=1/C15H30O3/c16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15(17)18/h16H,1-14H2,(H,17,18)/p-1 |
| EINECS |
225-026-1 |
| Molecular Structure |
|
| Melting point |
97℃ |
| Boiling point |
400.9°C at 760 mmHg |
| Flash point |
210.4°C |
| Vapour Pressur |
4.3E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
