ChemNet > CAS > 4621-66-3 Thionicotinamide
4621-66-3 Thionicotinamide
| product Name |
Thionicotinamide |
| Synonyms |
Pyridine-3-thiocarboxamide; Pyridine-3-carbothioamide |
| Molecular Formula |
C6H6N2S |
| Molecular Weight |
138.1902 |
| InChI |
InChI=1/C6H6N2S/c7-6(9)5-2-1-3-8-4-5/h1-4H,(H2,7,9) |
| CAS Registry Number |
4621-66-3 |
| EINECS |
225-036-6 |
| Molecular Structure |
|
| Density |
1.265g/cm3 |
| Melting point |
185-190℃ |
| Boiling point |
278.9°C at 760 mmHg |
| Refractive index |
1.664 |
| Flash point |
122.5°C |
| Vapour Pressur |
0.00415mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
