ChemNet > CAS > 4630-80-2 Methyl cyclopentanecarboxylate
4630-80-2 Methyl cyclopentanecarboxylate
| product Name |
Methyl cyclopentanecarboxylate |
| CAS No |
4630-80-2 |
| Synonyms |
Cyclopentanecarboxylic acid methyl ester; Methyl cyclopentane carboxylate |
| Molecular Formula |
C7H12O2 |
| Molecular Weight |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-9-7(8)6-4-2-3-5-6/h6H,2-5H2,1H3 |
| EINECS |
225-049-7 |
| Molecular Structure |
|
| Density |
1.014g/cm3 |
| Boiling point |
159°C at 760 mmHg |
| Refractive index |
1.45 |
| Flash point |
43.6°C |
| Vapour Pressur |
2.55mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
