ChemNet > CAS > 4651-82-5 2-aminothiophene-3-carbonitrile
4651-82-5 2-aminothiophene-3-carbonitrile
| product Name |
2-aminothiophene-3-carbonitrile |
| CAS No |
4651-82-5 |
| Synonyms |
2-Amino-3-cyanothiophene; 2-Amino-3-thiophenecarbonitrile |
| Molecular Formula |
C5H4N2S |
| Molecular Weight |
124.1637 |
| InChI |
InChI=1/C5H4N2S/c6-3-4-1-2-8-5(4)7/h1-2H,7H2 |
| Molecular Structure |
|
| Density |
1.33g/cm3 |
| Melting point |
104℃ |
| Boiling point |
317.5°C at 760 mmHg |
| Refractive index |
1.627 |
| Flash point |
145.8°C |
| Vapour Pressur |
0.000384mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
