ChemNet > CAS > 4651-97-2 2-amino-4-methylthiophene-3-carboxamide
4651-97-2 2-amino-4-methylthiophene-3-carboxamide
| product Name |
2-amino-4-methylthiophene-3-carboxamide |
| CAS No |
4651-97-2 |
| Molecular Formula |
C6H8N2OS |
| Molecular Weight |
156.2055 |
| InChI |
InChI=1/C6H8N2OS/c1-3-2-10-6(8)4(3)5(7)9/h2H,8H2,1H3,(H2,7,9) |
| Molecular Structure |
|
| Density |
1.344g/cm3 |
| Melting point |
173℃ |
| Boiling point |
277.1°C at 760 mmHg |
| Refractive index |
1.654 |
| Flash point |
121.4°C |
| Vapour Pressur |
0.00462mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
