ChemNet > CAS > 4652-27-1 4-Methoxy-3-buten-2-one
4652-27-1 4-Methoxy-3-buten-2-one
| product Name |
4-Methoxy-3-buten-2-one |
| CAS No |
4652-27-1 |
| Synonyms |
4-Methoxybut-3-en-2-one; (3E)-4-methoxybut-3-en-2-one; (3Z)-4-methoxybut-3-en-2-one |
| Molecular Formula |
C5H8O2 |
| Molecular Weight |
100.1158 |
| InChI |
InChI=1/C5H8O2/c1-5(6)3-4-7-2/h3-4H,1-2H3/b4-3- |
| EINECS |
225-087-4 |
| Molecular Structure |
|
| Density |
0.925g/cm3 |
| Boiling point |
200°C at 760 mmHg |
| Refractive index |
1.414 |
| Flash point |
63.3°C |
| Vapour Pressur |
0.332mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
