ChemNet > CAS > 4653-08-1 3-(2-thenoyl)propionic acid
4653-08-1 3-(2-thenoyl)propionic acid
| product Name |
3-(2-thenoyl)propionic acid |
| Synonyms |
4-Oxo-4-(2-thienyl)butyric acid; 4-oxo-4-(thiophen-2-yl)butanoic acid; 4-oxo-4-thiophen-2-ylbutanoate |
| Molecular Formula |
C8H7O3S |
| Molecular Weight |
183.2049 |
| InChI |
InChI=1/C8H8O3S/c9-6(3-4-8(10)11)7-2-1-5-12-7/h1-2,5H,3-4H2,(H,10,11)/p-1 |
| CAS Registry Number |
4653-08-1 |
| EINECS |
225-089-5 |
| Molecular Structure |
|
| Boiling point |
400.5°C at 760 mmHg |
| Flash point |
196°C |
| Vapour Pressur |
3.93E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
