ChemNet > CAS > 4653-11-6 4-(2-Thienyl)butyric acid
4653-11-6 4-(2-Thienyl)butyric acid
| product Name |
4-(2-Thienyl)butyric acid |
| CAS No |
4653-11-6 |
| Synonyms |
2-Thiophenebutyric acid; 4-(thiophen-2-yl)butanoic acid; 4-thiophen-2-ylbutanoate |
| Molecular Formula |
C8H9O2S |
| Molecular Weight |
169.2214 |
| InChI |
InChI=1/C8H10O2S/c9-8(10)5-1-3-7-4-2-6-11-7/h2,4,6H,1,3,5H2,(H,9,10)/p-1 |
| EINECS |
225-090-0 |
| Molecular Structure |
|
| Boiling point |
296.9°C at 760 mmHg |
| Flash point |
133.4°C |
| Vapour Pressur |
0.000628mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
