ChemNet > CAS > 465514-59-4 1-(2,6-difluorophenyl)-2-phenyl-1-ethanone
465514-59-4 1-(2,6-difluorophenyl)-2-phenyl-1-ethanone
| product Name |
1-(2,6-difluorophenyl)-2-phenyl-1-ethanone |
| CAS No |
465514-59-4 |
| Synonyms |
1-(2,6-difluorophenyl)-2-phenylethanone |
| Molecular Formula |
C14H10F2O |
| Molecular Weight |
232.2254 |
| InChI |
InChI=1/C14H10F2O/c15-11-7-4-8-12(16)14(11)13(17)9-10-5-2-1-3-6-10/h1-8H,9H2 |
| Molecular Structure |
|
| Density |
1.221g/cm3 |
| Boiling point |
317.6°C at 760 mmHg |
| Refractive index |
1.552 |
| Flash point |
121.8°C |
| Vapour Pressur |
0.000381mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
