ChemNet > CAS > 465514-80-1 1-(3-fluorophenyl)-2-(3-methoxyphenyl)-1-ethanone
465514-80-1 1-(3-fluorophenyl)-2-(3-methoxyphenyl)-1-ethanone
| product Name |
1-(3-fluorophenyl)-2-(3-methoxyphenyl)-1-ethanone |
| CAS No |
465514-80-1 |
| Synonyms |
1-(3-fluorophenyl)-2-(3-methoxyphenyl)ethanone |
| Molecular Formula |
C15H13FO2 |
| Molecular Weight |
244.2609 |
| InChI |
InChI=1/C15H13FO2/c1-18-14-7-2-4-11(8-14)9-15(17)12-5-3-6-13(16)10-12/h2-8,10H,9H2,1H3 |
| Molecular Structure |
|
| Density |
1.163g/cm3 |
| Boiling point |
367.4°C at 760 mmHg |
| Refractive index |
1.555 |
| Flash point |
170°C |
| Vapour Pressur |
1.37E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
