ChemNet > CAS > 46828-05-1 dimethyl 5-isocyanatoisophthalate
46828-05-1 dimethyl 5-isocyanatoisophthalate
| product Name |
dimethyl 5-isocyanatoisophthalate |
| CAS No |
46828-05-1 |
| Synonyms |
Dimethyl 5-(isocyanato)isophthalate; 3,5-Bis(methoxycarbonyl)phenyl isocyanate; dimethyl 5-isocyanatobenzene-1,3-dicarboxylate |
| Molecular Formula |
C11H9NO5 |
| Molecular Weight |
235.1929 |
| InChI |
InChI=1/C11H9NO5/c1-16-10(14)7-3-8(11(15)17-2)5-9(4-7)12-6-13/h3-5H,1-2H3 |
| Molecular Structure |
|
| Density |
1.24g/cm3 |
| Boiling point |
350.3°C at 760 mmHg |
| Refractive index |
1.533 |
| Flash point |
164.1°C |
| Vapour Pressur |
4.44E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/22:Harmful by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42:May cause sensitization by inhalation.;
|
| Safety Description |
S22:Do not inhale dust.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
