ChemNet > CAS > 4685-47-6 3,4-Dimethylanisole
4685-47-6 3,4-Dimethylanisole
| product Name |
3,4-Dimethylanisole |
| CAS No |
4685-47-6 |
| Synonyms |
1,2-Dimethyl-4-methoxybenzene; 4-Methoxy-o-xylene; 3-(methoxycarbonyl)-1-methylpyridinium; 4-methoxy-1,2-dimethyl-benzene |
| Molecular Formula |
C9H12O |
| Molecular Weight |
136.191 |
| InChI |
InChI=1/C9H12O/c1-7-4-5-9(10-3)6-8(7)2/h4-6H,1-3H3 |
| EINECS |
225-142-2 |
| Molecular Structure |
|
| Density |
0.932g/cm3 |
| Boiling point |
203.1°C at 760 mmHg |
| Refractive index |
1.495 |
| Flash point |
75.6°C |
| Vapour Pressur |
0.402mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
