ChemNet > CAS > 4702-32-3 DL-Isocitric acid lactone
4702-32-3 DL-Isocitric acid lactone
| product Name |
DL-Isocitric acid lactone |
| CAS No |
4702-32-3 |
| Synonyms |
DL-2-Oxotetrahydrofuran-4,5-dicarboxylic acid; DL-Isocitriclactone; tetrahydro-5-oxofuran-2,3-dicarboxylic acid; 5-oxotetrahydrofuran-2,3-dicarboxylic acid (non-preferred name); (2S,3S)-5-oxotetrahydrofuran-2,3-dicarboxylic acid (non-preferred name); (2S,3R)-5-oxotetrahydrofuran-2,3-dicarboxylate (non-preferred name); (2R,3R)-5-oxotetrahydrofuran-2,3-dicarboxylate (non-preferred name); (2S,3S)-5-oxotetrahydrofuran-2,3-dicarboxylate (non-preferred name); (2R,3S)-5-oxotetrahydrofuran-2,3-dicarboxylate (non-preferred name) |
| Molecular Formula |
C6H4O6 |
| Molecular Weight |
172.0935 |
| InChI |
InChI=1/C6H6O6/c7-3-1-2(5(8)9)4(12-3)6(10)11/h2,4H,1H2,(H,8,9)(H,10,11)/p-2/t2-,4+/m0/s1 |
| EINECS |
225-178-9 |
| Molecular Structure |
|
| Melting point |
158-164℃ |
| Boiling point |
586.8°C at 760 mmHg |
| Flash point |
253.3°C |
| Vapour Pressur |
2.74E-15mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
