ChemNet > CAS > 4705-34-4 4,4'-Dimethoxystilbene
4705-34-4 4,4'-Dimethoxystilbene
| product Name |
4,4'-Dimethoxystilbene |
| CAS No |
4705-34-4 |
| Synonyms |
1-methoxy-4-((E)-2-(4-methoxyphenyl)ethenyl)benzene
; 1,1'-ethene-1,2-diylbis(4-methoxybenzene); 1,1'-(E)-ethene-1,2-diylbis(4-methoxybenzene) |
| Molecular Formula |
C16H16O2 |
| Molecular Weight |
240.297 |
| InChI |
InChI=1/C16H16O2/c1-17-15-9-5-13(6-10-15)3-4-14-7-11-16(18-2)12-8-14/h3-12H,1-2H3/b4-3+ |
| EINECS |
225-189-9 |
| Molecular Structure |
|
| Density |
1.089g/cm3 |
| Melting point |
213-215℃ |
| Boiling point |
391.3°C at 760 mmHg |
| Refractive index |
1.615 |
| Flash point |
159.3°C |
| Vapour Pressur |
5.61E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
