ChemNet > CAS > 4707-46-4 2,4-Dihydroxy-3,6-dimethylbenzoic acid
4707-46-4 2,4-Dihydroxy-3,6-dimethylbenzoic acid
| product Name |
2,4-Dihydroxy-3,6-dimethylbenzoic acid |
| CAS No |
4707-46-4 |
| Synonyms |
3,6-Dimethyl-2,4-dihydroxybenzoic acid |
| Molecular Formula |
C9H10O4 |
| Molecular Weight |
182.1733 |
| InChI |
InChI=1/C9H10O4/c1-4-3-6(10)5(2)8(11)7(4)9(12)13/h3,10-11H,1-2H3,(H,12,13) |
| Molecular Structure |
|
| Density |
1.386g/cm3 |
| Boiling point |
407.4°C at 760 mmHg |
| Refractive index |
1.627 |
| Flash point |
214.3°C |
| Vapour Pressur |
2.29E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
