ChemNet > CAS > 4731-53-7 Tri-n-octylphosphine
4731-53-7 Tri-n-octylphosphine
| product Name |
Tri-n-octylphosphine |
| CAS No |
4731-53-7 |
| Synonyms |
Phosphine, trioctyl-; Trioctylphosphine; trioctylphosphane; Trioctyl phosphine |
| Molecular Formula |
C24H51P |
| Molecular Weight |
370.6355 |
| InChI |
InChI=1/C24H51P/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3/h4-24H2,1-3H3 |
| EINECS |
225-234-2 |
| Molecular Structure |
|
| Boiling point |
445°C at 760 mmHg |
| Flash point |
236°C |
| Vapour Pressur |
1.07E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
