ChemNet > CAS > 477-75-8 Triptycene
477-75-8 Triptycene
| product Name |
Triptycene |
| CAS No |
477-75-8 |
| Synonyms |
9,10-o-Benzeno-9,10-dihydroanthracene; pentacyclo[6.6.6.0~2,7~.0~9,14~.0~15,20~]icosa-2,4,6,9,11,13,15,17,19-nonaene (non-preferred name) |
| Molecular Formula |
C20H14 |
| Molecular Weight |
254.3252 |
| InChI |
InChI=1/C20H14/c1-2-8-14-13(7-1)19-15-9-3-5-11-17(15)20(14)18-12-6-4-10-16(18)19/h1-12,19-20H |
| EINECS |
207-519-3 |
| Molecular Structure |
|
| Density |
1.197g/cm3 |
| Melting point |
252-256℃ |
| Boiling point |
371.8°C at 760 mmHg |
| Refractive index |
1.688 |
| Flash point |
171.7°C |
| Vapour Pressur |
2.15E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
