ChemNet > CAS > 4787-77-3 2-(1-Pyrrolidino)phenol
4787-77-3 2-(1-Pyrrolidino)phenol
| product Name |
2-(1-Pyrrolidino)phenol |
| CAS No |
4787-77-3 |
| Synonyms |
2-Pyrrolidinophenol, [1-(2-Hydroxyphenyl)pyrrolidine]; 1-(2-Hydroxyphenyl)pyrrolidine; 2-pyrrolidin-1-ylphenol |
| Molecular Formula |
C10H13NO |
| Molecular Weight |
163.2163 |
| InChI |
InChI=1/C10H13NO/c12-10-6-2-1-5-9(10)11-7-3-4-8-11/h1-2,5-6,12H,3-4,7-8H2 |
| Molecular Structure |
|
| Density |
1.146g/cm3 |
| Boiling point |
279.1°C at 760 mmHg |
| Refractive index |
1.594 |
| Flash point |
139.6°C |
| Vapour Pressur |
0.00242mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|
