ChemNet > CAS > 4792-58-9 5-methoxyindole-2-carboxylic acid ethyl ester
4792-58-9 5-methoxyindole-2-carboxylic acid ethyl ester
| product Name |
5-methoxyindole-2-carboxylic acid ethyl ester |
| CAS No |
4792-58-9 |
| Synonyms |
1H-Indole-2-carboxylic acid, 5-methoxy-, ethyl ester; 1H-Indole-2-carboxylic acid, 5-methoxy-, ethyl ester; 5-22-05-00181 (Beilstein Handbook Reference); Ethyl 5-methoxy-1H-indole-2-carboxylate; Methoxy-5 indole carboxylate d'ethyle-2; Ethyl 5-methoxyindole-2-carboxylate |
| Molecular Formula |
C12H13NO3 |
| Molecular Weight |
219.2365 |
| InChI |
InChI=1/C12H13NO3/c1-3-16-12(14)11-7-8-6-9(15-2)4-5-10(8)13-11/h4-7,13H,3H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.216g/cm3 |
| Boiling point |
380.2°C at 760 mmHg |
| Refractive index |
1.599 |
| Flash point |
183.7°C |
| Vapour Pressur |
5.54E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
