ChemNet > CAS > 4815-30-9 Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate
4815-30-9 Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate
| product Name |
Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate |
| CAS No |
4815-30-9 |
| Synonyms |
5-Amino-3-methyl-2,4-thiophenedicarboxilic acid diethyl ester; diethyl 5-amino-3-methylthiophene-2,4-dicarboxylate |
| Molecular Formula |
C11H15NO4S |
| Molecular Weight |
257.3061 |
| InChI |
InChI=1/C11H15NO4S/c1-4-15-10(13)7-6(3)8(17-9(7)12)11(14)16-5-2/h4-5,12H2,1-3H3 |
| EINECS |
225-388-0 |
| Molecular Structure |
|
| Density |
1.247g/cm3 |
| Melting point |
103-108℃ |
| Boiling point |
372.6°C at 760 mmHg |
| Refractive index |
1.558 |
| Flash point |
179.1°C |
| Vapour Pressur |
9.51E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
