ChemNet > CAS > 4837-20-1 4-(difluoromethoxy)benzoic acid
4837-20-1 4-(difluoromethoxy)benzoic acid
| product Name |
4-(difluoromethoxy)benzoic acid |
| CAS No |
4837-20-1 |
| Synonyms |
4-(difluoromethoxy)benzoate |
| Molecular Formula |
C8H5F2O3 |
| Molecular Weight |
187.1209 |
| InChI |
InChI=1/C8H6F2O3/c9-8(10)13-6-3-1-5(2-4-6)7(11)12/h1-4,8H,(H,11,12)/p-1 |
| Molecular Structure |
|
| Melting point |
169-171℃ |
| Boiling point |
272.1°C at 760 mmHg |
| Flash point |
118.3°C |
| Vapour Pressur |
0.00304mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|
