ChemNet > CAS > 4845-50-5 trans-2,3-dihydroxy-1,4-dioxane
4845-50-5 trans-2,3-dihydroxy-1,4-dioxane
| product Name |
trans-2,3-dihydroxy-1,4-dioxane |
| CAS No |
4845-50-5 |
| Synonyms |
2,3-Dihydroxy-1,4-dioxane; Glyoxal monoethylene acetal; Dioxanediol; 1,4-dioxane-2,3-diol; trans-1,4-Dioxane-2,3-diol |
| Molecular Formula |
C4H8O4 |
| Molecular Weight |
120.1039 |
| InChI |
InChI=1/C4H8O4/c5-3-4(6)8-2-1-7-3/h3-6H,1-2H2 |
| EINECS |
225-431-3 |
| Molecular Structure |
|
| Density |
1.455g/cm3 |
| Melting point |
91-95℃ |
| Boiling point |
259.4°C at 760 mmHg |
| Refractive index |
1.513 |
| Flash point |
110.7°C |
| Vapour Pressur |
0.00189mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36:Irritating to eyes.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
