ChemNet > CAS > 485-63-2 3',4',7-Trihydroxyisoflavone
485-63-2 3',4',7-Trihydroxyisoflavone
| product Name |
3',4',7-Trihydroxyisoflavone |
| CAS No |
485-63-2 |
| Synonyms |
7,3',4'-Trihydroxyisoflavone; 4H-1-Benzopyran-4-one, 3-(3,4-dihydroxyphenyl)-7-hydroxy-; 3-(3,4-dihydroxyphenyl)-7-hydroxy-4H-chromen-4-one |
| Molecular Formula |
C15H10O5 |
| Molecular Weight |
270.2369 |
| InChI |
InChI=1/C15H10O5/c16-9-2-3-10-14(6-9)20-7-11(15(10)19)8-1-4-12(17)13(18)5-8/h1-7,16-18H |
| Molecular Structure |
|
| Density |
1.548g/cm3 |
| Boiling point |
572.8°C at 760 mmHg |
| Refractive index |
1.732 |
| Flash point |
224°C |
| Vapour Pressur |
1.01E-13mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S22:;
S24/25:;
|
|
