ChemNet > CAS > 488-81-3 Adonitol
488-81-3 Adonitol
| product Name |
Adonitol |
| CAS No |
488-81-3 |
| Synonyms |
Ribitol; Ribit = Ribitol = Adonitol; pentitol; D-ribitol; (2S,4R)-pentane-1,2,3,4,5-pentol |
| Molecular Formula |
C5H12O5 |
| Molecular Weight |
152.1458 |
| InChI |
InChI=1/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5? |
| EINECS |
207-685-7 |
| Molecular Structure |
|
| Density |
1.525g/cm3 |
| Melting point |
101-104℃ |
| Boiling point |
494.5°C at 760 mmHg |
| Refractive index |
1.57 |
| Flash point |
261.9°C |
| Vapour Pressur |
7.47E-12mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
