ChemNet > CAS > 4884-24-6 Cyclopentylcyclopentanon
4884-24-6 Cyclopentylcyclopentanon
| product Name |
Cyclopentylcyclopentanon |
| CAS No |
4884-24-6 |
| Synonyms |
2-Cyclopentylcyclopentanone; 1,1'-bi(cyclopentyl)-2-one |
| Molecular Formula |
C10H16O |
| Molecular Weight |
152.2334 |
| InChI |
InChI=1/C10H16O/c11-10-7-3-6-9(10)8-4-1-2-5-8/h8-9H,1-7H2 |
| EINECS |
225-495-2 |
| Molecular Structure |
|
| Density |
1.031g/cm3 |
| Boiling point |
232.5°C at 760 mmHg |
| Refractive index |
1.512 |
| Flash point |
90.3°C |
| Vapour Pressur |
0.0588mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
