ChemNet > CAS > 4900-63-4 1-Methoxy-4-nitronaphthalene
4900-63-4 1-Methoxy-4-nitronaphthalene
| product Name |
1-Methoxy-4-nitronaphthalene |
| CAS No |
4900-63-4 |
| Synonyms |
methyl 4-nitronaphthyl ether |
| Molecular Formula |
C11H9NO3 |
| Molecular Weight |
203.1941 |
| InChI |
InChI=1/C11H9NO3/c1-15-11-7-6-10(12(13)14)8-4-2-3-5-9(8)11/h2-7H,1H3 |
| EINECS |
225-528-0 |
| Molecular Structure |
|
| Density |
1.274g/cm3 |
| Melting point |
83-85℃ |
| Boiling point |
367.2°C at 760 mmHg |
| Refractive index |
1.638 |
| Flash point |
178.3°C |
| Vapour Pressur |
2.93E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
