ChemNet > CAS > 4916-57-8 1,2-Bis(4-pyridyl)ethane
4916-57-8 1,2-Bis(4-pyridyl)ethane
| product Name |
1,2-Bis(4-pyridyl)ethane |
| CAS No |
4916-57-8 |
| Molecular Formula |
C12H12N2 |
| Molecular Weight |
184.2371 |
| InChI |
InChI=1/C12H12N2/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12/h3-10H,1-2H2 |
| EINECS |
225-543-2 |
| Molecular Structure |
|
| Density |
1.087g/cm3 |
| Melting point |
107-113℃ |
| Boiling point |
310.3°C at 760 mmHg |
| Refractive index |
1.581 |
| Flash point |
117.2°C |
| Vapour Pressur |
0.00111mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
