ChemNet > CAS > 4919-33-9 4-Ethoxyphenylacetic acid
4919-33-9 4-Ethoxyphenylacetic acid
| product Name |
4-Ethoxyphenylacetic acid |
| Synonyms |
Benzeneacetic acid, 4-ethoxy-; (4-ethoxyphenyl)acetate |
| Molecular Formula |
C10H11O3 |
| Molecular Weight |
179.1931 |
| InChI |
InChI=1/C10H12O3/c1-2-13-9-5-3-8(4-6-9)7-10(11)12/h3-6H,2,7H2,1H3,(H,11,12)/p-1 |
| CAS Registry Number |
4919-33-9 |
| EINECS |
225-545-3 |
| Molecular Structure |
|
| Melting point |
86-90℃ |
| Boiling point |
318.5°C at 760 mmHg |
| Flash point |
125.8°C |
| Vapour Pressur |
0.000151mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
