ChemNet > CAS > 4920-80-3 3-Methoxy-2-nitrobenzoic acid
4920-80-3 3-Methoxy-2-nitrobenzoic acid
| product Name |
3-Methoxy-2-nitrobenzoic acid |
| Synonyms |
2-Nitro-m-anisic acid; 3-methoxy-2-nitrobenzoate; 2-NITRO-3-METHOXYBENZOIC ACID |
| Molecular Formula |
C8H6NO5 |
| Molecular Weight |
196.1375 |
| InChI |
InChI=1/C8H7NO5/c1-14-6-4-2-3-5(8(10)11)7(6)9(12)13/h2-4H,1H3,(H,10,11)/p-1 |
| CAS Registry Number |
4920-80-3 |
| EINECS |
225-549-5 |
| Molecular Structure |
|
| Melting point |
253-258℃ |
| Boiling point |
388.2°C at 760 mmHg |
| Flash point |
188.6°C |
| Vapour Pressur |
1.01E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
