4946-13-8 4-Ethylthiophenol
| product Name |
4-Ethylthiophenol |
| CAS No |
4946-13-8 |
| Synonyms |
4-Ethylbenzenethiol; 4-ethylbenzenethiolate |
| Molecular Formula |
C8H9S |
| Molecular Weight |
137.2226 |
| InChI |
InChI=1/C8H10S/c1-2-7-3-5-8(9)6-4-7/h3-6,9H,2H2,1H3/p-1 |
| Molecular Structure |
|
| Boiling point |
211.7°C at 760 mmHg |
| Flash point |
84°C |
| Vapour Pressur |
0.262mmHg at 25°C |
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36:Irritating to eyes.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
Featured China Suppliers
| Telephone |
+86-571-88902507;88902517;88902509 |
| Email |
shoufu@shoufuchem.com |
| Address |
5/F, Yangfan Venture Plaza, 31 Xincheng Road, Binjiang District, Hangzhou City, Zhejiang Province, P.R.China |