ChemNet > CAS > 496-46-8 Glycoluril
496-46-8 Glycoluril
| product Name |
Glycoluril |
| CAS No |
496-46-8 |
| Synonyms |
Acetyleneurea; Tetrahydroimidazo[4,5-d]imidazole-2,5-(1H,3H)-dione; perhydroimidazo(4,5-d)imidazole-2,5-dione; di-1,2-ureyleneethane |
| Molecular Formula |
C4H6N4O2 |
| Molecular Weight |
142.116 |
| InChI |
InChI=1/C4H6N4O2/c9-3-5-1-2(7-3)8-4(10)6-1/h1-2H,(H2,5,7,9)(H2,6,8,10) |
| EINECS |
207-821-5 |
| Molecular Structure |
|
| Density |
1.42g/cm3 |
| Melting point |
>300℃ |
| Boiling point |
861.6°C at 760 mmHg |
| Refractive index |
1.514 |
| Flash point |
421.8°C |
| Vapour Pressur |
4.61E-30mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
