ChemNet > CAS > 496-76-4 2,4,5-Trihydroxypyrimidine
496-76-4 2,4,5-Trihydroxypyrimidine
| product Name |
2,4,5-Trihydroxypyrimidine |
| CAS No |
496-76-4 |
| Synonyms |
Isobarbituric acid; 5-hydroxypyrimidine-2,4(1H,3H)-dione; dihydropyrimidine-2,4,5(3H)-trione |
| Molecular Formula |
C4H4N2O3 |
| Molecular Weight |
128.0862 |
| InChI |
InChI=1/C4H4N2O3/c7-2-1-5-4(9)6-3(2)8/h1H2,(H2,5,6,8,9) |
| EINECS |
207-829-9 |
| Molecular Structure |
|
| Density |
1.455g/cm3 |
| Melting point |
300℃ |
| Refractive index |
1.492 |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
