ChemNet > CAS > 49623-71-4 2,4,6-Triisopropylbenzoic acid
49623-71-4 2,4,6-Triisopropylbenzoic acid
| product Name |
2,4,6-Triisopropylbenzoic acid |
| CAS No |
49623-71-4 |
| Synonyms |
2,4,6-Tris(1-methylethyl)benzoic acid; 2,4,6-tri(propan-2-yl)benzoic acid; 2,4,6-tris(1-methylethyl)benzoate |
| Molecular Formula |
C16H23O2 |
| Molecular Weight |
247.3532 |
| InChI |
InChI=1/C16H24O2/c1-9(2)12-7-13(10(3)4)15(16(17)18)14(8-12)11(5)6/h7-11H,1-6H3,(H,17,18)/p-1 |
| EINECS |
256-400-2 |
| Molecular Structure |
|
| Melting point |
186-187℃ |
| Boiling point |
318.7°C at 760 mmHg |
| Flash point |
158.6°C |
| Vapour Pressur |
0.000149mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
