ChemNet > CAS > 4964-71-0 5-Bromo-quinoline
4964-71-0 5-Bromo-quinoline
| product Name |
5-Bromo-quinoline |
| CAS No |
4964-71-0 |
| Synonyms |
5-Bromoquinoline; RARECHEM AK ML 0010; 5-Bromoquinoline,97% |
| Molecular Formula |
C9H6BrN |
| Molecular Weight |
208.0546 |
| InChI |
InChI=1/C9H6BrN/c10-8-4-1-5-9-7(8)3-2-6-11-9/h1-6H |
| Molecular Structure |
|
| Density |
1.564g/cm3 |
| Boiling point |
295.9°C at 760 mmHg |
| Refractive index |
1.673 |
| Flash point |
132.8°C |
| Vapour Pressur |
0.00261mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
