ChemNet > CAS > 49647-20-3 4-acetylphenyl isocyanate
49647-20-3 4-acetylphenyl isocyanate
| product Name |
4-acetylphenyl isocyanate |
| CAS No |
49647-20-3 |
| Synonyms |
4-Isocyanatoacetophenone; 1-(4-isocyanatophenyl)ethanone |
| Molecular Formula |
C9H7NO2 |
| Molecular Weight |
161.1574 |
| InChI |
InChI=1/C9H7NO2/c1-7(12)8-2-4-9(5-3-8)10-6-11/h2-5H,1H3 |
| Molecular Structure |
|
| Density |
1.09g/cm3 |
| Melting point |
35-37℃ |
| Boiling point |
268.7°C at 760 mmHg |
| Refractive index |
1.537 |
| Flash point |
107.7°C |
| Vapour Pressur |
0.00756mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/22:Harmful by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42:May cause sensitization by inhalation.;
|
| Safety Description |
S22:Do not inhale dust.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
