ChemNet > CAS > 497-09-6 L-(-)-glyceraldehyde
497-09-6 L-(-)-glyceraldehyde
| product Name |
L-(-)-glyceraldehyde |
| CAS No |
497-09-6 |
| Synonyms |
L-(-)-Glyceraldehyd; (2S)-2,3-dihydroxypropanal; L-Glyceraldehyde |
| Molecular Formula |
C3H6O3 |
| Molecular Weight |
90.0779 |
| InChI |
InChI=1/C3H6O3/c4-1-3(6)2-5/h1,3,5-6H,2H2/t3-/m1/s1 |
| EINECS |
207-836-7 |
| Molecular Structure |
|
| Density |
1.272g/cm3 |
| Boiling point |
228°C at 760 mmHg |
| Refractive index |
1.454 |
| Flash point |
106°C |
| Vapour Pressur |
0.0146mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
