ChemNet > CAS > 4971-56-6 Tetrahydrofuran-2,4-dione
4971-56-6 Tetrahydrofuran-2,4-dione
| product Name |
Tetrahydrofuran-2,4-dione |
| CAS No |
4971-56-6 |
| Synonyms |
Tetronicacidmin; beta-oxo-gamma-butyrolactone; 4-Hydroxy-2(5H)-furanone; Tetrahydro-2,4-furandione; 2,4(3H,5H)-Furandione; furan-2,4(3H,5H)-dione |
| Molecular Formula |
C4H4O3 |
| Molecular Weight |
100.0728 |
| InChI |
InChI=1/C4H4O3/c5-3-1-4(6)7-2-3/h1-2H2 |
| EINECS |
225-617-4 |
| Molecular Structure |
|
| Density |
1.375g/cm3 |
| Melting point |
142-147℃ |
| Boiling point |
324.3°C at 760 mmHg |
| Refractive index |
1.47 |
| Flash point |
151.1°C |
| Vapour Pressur |
0.000248mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
