ChemNet > CAS > 49763-65-7 4-Pentylbenzoyl chloride
49763-65-7 4-Pentylbenzoyl chloride
| product Name |
4-Pentylbenzoyl chloride |
| CAS No |
49763-65-7 |
| Synonyms |
4-n-Amylbenzoyl chloride; Benzoyl chloride, 4-pentyl- |
| Molecular Formula |
C12H15ClO |
| Molecular Weight |
210.6999 |
| InChI |
InChI=1/C12H15ClO/c1-2-3-4-5-10-6-8-11(9-7-10)12(13)14/h6-9H,2-5H2,1H3 |
| EINECS |
256-478-8 |
| Molecular Structure |
|
| Density |
1.063g/cm3 |
| Boiling point |
288.4°C at 760 mmHg |
| Refractive index |
1.516 |
| Flash point |
130.3°C |
| Vapour Pressur |
0.00234mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
