ChemNet > CAS > 498-74-8 4-Methoxymetanilyl fluoride
498-74-8 4-Methoxymetanilyl fluoride
| product Name |
4-Methoxymetanilyl fluoride |
| CAS No |
498-74-8 |
| Synonyms |
3-amino-4-methoxyphenylsulphonyl fluoride; Aminomethoxybenzenesulfonylfluoride; 3-Amino-4-methoxAV21428; 3-amino-4-methoxybenzenesulfonyl fluoride; 3-fluorobenzohydrazide |
| Molecular Formula |
C7H7FN2O |
| Molecular Weight |
154.1417 |
| InChI |
InChI=1/C7H7FN2O/c8-6-3-1-2-5(4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
| EINECS |
207-870-2 |
| Molecular Structure |
|
| Density |
1.272g/cm3 |
| Melting point |
60-65℃ |
| Boiling point |
312.6°C at 760 mmHg |
| Refractive index |
1.552 |
| Flash point |
142.8°C |
| Vapour Pressur |
0.000224mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
