ChemNet > CAS > 4981-63-9 4'-Chlorobutyrophenone
4981-63-9 4'-Chlorobutyrophenone
| product Name |
4'-Chlorobutyrophenone |
| CAS No |
4981-63-9 |
| Synonyms |
1-(4-Chlorophenyl)-1-butanone; 4-Chlorobutyrophenone; 1-(4-chlorophenyl)butan-1-one; 4-chloro-1-phenylbutan-1-one |
| Molecular Formula |
C10H11ClO |
| Molecular Weight |
182.6467 |
| InChI |
InChI=1/C10H11ClO/c11-8-4-7-10(12)9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2 |
| EINECS |
225-631-0 |
| Molecular Structure |
|
| Density |
1.104g/cm3 |
| Melting point |
36-39℃ |
| Boiling point |
285.9°C at 760 mmHg |
| Refractive index |
1.521 |
| Flash point |
145.5°C |
| Vapour Pressur |
0.00272mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
