ChemNet > CAS > 499770-67-1 1-Methyl-1H-1,2,3-benzotriazole-5-carbaldehyde
499770-67-1 1-Methyl-1H-1,2,3-benzotriazole-5-carbaldehyde
| product Name |
1-Methyl-1H-1,2,3-benzotriazole-5-carbaldehyde |
| CAS No |
499770-67-1 |
| Synonyms |
1-methyl-1H-benzo[d][1,2,3]triazole-5-carbaldehyde; 1-methylbenzotriazole-5-carbaldehyde |
| Molecular Formula |
C8H7N3O |
| Molecular Weight |
161.1607 |
| InChI |
InChI=1/C8H7N3O/c1-11-8-3-2-6(5-12)4-7(8)9-10-11/h2-5H,1H3 |
| Molecular Structure |
|
| Density |
1.333g/cm3 |
| Melting point |
159℃ |
| Boiling point |
354.124°C at 760 mmHg |
| Refractive index |
1.668 |
| Flash point |
167.968°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
