ChemNet > CAS > 499771-07-2 1-benzyl-4-(3-nitropyridin-2-yl)piperazine
499771-07-2 1-benzyl-4-(3-nitropyridin-2-yl)piperazine
| product Name |
1-benzyl-4-(3-nitropyridin-2-yl)piperazine |
| CAS No |
499771-07-2 |
| Molecular Formula |
C16H18N4O2 |
| Molecular Weight |
298.3397 |
| InChI |
InChI=1/C16H18N4O2/c21-20(22)15-7-4-8-17-16(15)19-11-9-18(10-12-19)13-14-5-2-1-3-6-14/h1-8H,9-13H2 |
| Molecular Structure |
|
| Density |
1.263g/cm3 |
| Melting point |
64℃ |
| Boiling point |
453°C at 760 mmHg |
| Refractive index |
1.628 |
| Flash point |
227.7°C |
| Vapour Pressur |
2.15E-08mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
