ChemNet > CAS > 499771-09-4 methyl 3-amino-4-cyano-5-piperidinothiophene-2-carboxylate
499771-09-4 methyl 3-amino-4-cyano-5-piperidinothiophene-2-carboxylate
| product Name |
methyl 3-amino-4-cyano-5-piperidinothiophene-2-carboxylate |
| CAS No |
499771-09-4 |
| Synonyms |
methyl 3-amino-4-cyano-5-piperidin-1-ylthiophene-2-carboxylate |
| Molecular Formula |
C12H15N3O2S |
| Molecular Weight |
265.3314 |
| InChI |
InChI=1/C12H15N3O2S/c1-17-12(16)10-9(14)8(7-13)11(18-10)15-5-3-2-4-6-15/h2-6,14H2,1H3 |
| Molecular Structure |
|
| Density |
1.33g/cm3 |
| Melting point |
183℃ |
| Boiling point |
506.1°C at 760 mmHg |
| Refractive index |
1.613 |
| Flash point |
259.9°C |
| Vapour Pressur |
2.29E-10mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
