ChemNet > CAS > 499771-20-9 2-(1,4-oxazinan-2-ylmethyl)-1H-isoindole-1,3(2H)-dione
499771-20-9 2-(1,4-oxazinan-2-ylmethyl)-1H-isoindole-1,3(2H)-dione
| product Name |
2-(1,4-oxazinan-2-ylmethyl)-1H-isoindole-1,3(2H)-dione |
| CAS No |
499771-20-9 |
| Synonyms |
2-(morpholin-2-ylmethyl)-1H-isoindole-1,3(2H)-dione |
| Molecular Formula |
C13H14N2O3 |
| Molecular Weight |
246.2619 |
| InChI |
InChI=1/C13H14N2O3/c16-12-10-3-1-2-4-11(10)13(17)15(12)8-9-7-14-5-6-18-9/h1-4,9,14H,5-8H2 |
| Molecular Structure |
|
| Density |
1.297g/cm3 |
| Melting point |
141℃ |
| Boiling point |
407.7°C at 760 mmHg |
| Refractive index |
1.586 |
| Flash point |
200.4°C |
| Vapour Pressur |
7.37E-07mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
