ChemNet > CAS > 499785-47-6 (1-methyl-5-phenyl-1H-pyrazol-4-yl)methanol
499785-47-6 (1-methyl-5-phenyl-1H-pyrazol-4-yl)methanol
| product Name |
(1-methyl-5-phenyl-1H-pyrazol-4-yl)methanol |
| CAS No |
499785-47-6 |
| Molecular Formula |
C11H12N2O |
| Molecular Weight |
188.2258 |
| InChI |
InChI=1/C11H12N2O/c1-13-11(10(8-14)7-12-13)9-5-3-2-4-6-9/h2-7,14H,8H2,1H3 |
| Molecular Structure |
|
| Density |
1.14g/cm3 |
| Melting point |
100℃ |
| Boiling point |
377.2°C at 760 mmHg |
| Refractive index |
1.593 |
| Flash point |
181.9°C |
| Vapour Pressur |
2.32E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
