ChemNet > CAS > 499785-52-3 ethyl 1-methyl-1H-1,2,3-benzotriazole-5-carboxylate
499785-52-3 ethyl 1-methyl-1H-1,2,3-benzotriazole-5-carboxylate
| product Name |
ethyl 1-methyl-1H-1,2,3-benzotriazole-5-carboxylate |
| CAS No |
499785-52-3 |
| Synonyms |
ethyl 1-methyl-1H-benzo[d][1,2,3]triazole-5-carboxylate; ethyl 1-methylbenzotriazole-5-carboxylate |
| Molecular Formula |
C10H11N3O2 |
| Molecular Weight |
205.2132 |
| InChI |
InChI=1/C10H11N3O2/c1-3-15-10(14)7-4-5-9-8(6-7)11-12-13(9)2/h4-6H,3H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.292g/cm3 |
| Melting point |
98℃ |
| Boiling point |
356.961°C at 760 mmHg |
| Refractive index |
1.616 |
| Flash point |
169.684°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
