ChemNet > CAS > 5001-36-5 2-(Isopropylideneaminooxy)propionic acid
5001-36-5 2-(Isopropylideneaminooxy)propionic acid
| product Name |
2-(Isopropylideneaminooxy)propionic acid |
| CAS No |
5001-36-5 |
| Synonyms |
2-[(propan-2-ylideneamino)oxy]propanoic acid |
| Molecular Formula |
C6H11NO3 |
| Molecular Weight |
145.1564 |
| InChI |
InChI=1/C6H11NO3/c1-4(2)7-10-5(3)6(8)9/h5H,1-3H3,(H,8,9) |
| Molecular Structure |
|
| Density |
1.09g/cm3 |
| Boiling point |
235.8°C at 760 mmHg |
| Refractive index |
1.454 |
| Flash point |
96.4°C |
| Vapour Pressur |
0.0169mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
