ChemNet > CAS > 5002-26-6 4-Bromo-2-methylbiphenyl
5002-26-6 4-Bromo-2-methylbiphenyl
| product Name |
4-Bromo-2-methylbiphenyl |
| CAS No |
5002-26-6 |
| Molecular Formula |
C13H11Br |
| Molecular Weight |
247.1304 |
| InChI |
InChI=1/C13H11Br/c1-10-9-12(14)7-8-13(10)11-5-3-2-4-6-11/h2-9H,1H3 |
| Molecular Structure |
|
| Density |
1.32g/cm3 |
| Boiling point |
308.015°C at 760 mmHg |
| Refractive index |
1.592 |
| Flash point |
138.911°C |
| Vapour Pressur |
0.001mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
